C12H14FN2O4P — CID 67549531
[fluoro-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]phosphonic acid (PubChem CID 67549531) has the molecular formula C12H14FN2O4P and a molecular weight of 300.23 g/mol. Its IUPAC name is [fluoro-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]phosphonic acid.
| Compound Name | [fluoro-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 67549531 |
| Molecular Formula | C12H14FN2O4P |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [fluoro-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]phosphonic acid |
| SMILES | COc1cc(C(F)P(=O)(O)O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C12H14FN2O4P/c1-8-6-15(7-14-8)10-4-3-9(5-11(10)19-2)12(13)20(16,17)18/h3-7,12H,1-2H3,(H2,16,17,18) |
| InChIKey | RPTIULSAOACRHC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|