About 1-fluoro-2,3-dihydro-1H-inden-2-amine
1-fluoro-2,3-dihydro-1H-inden-2-amine (PubChem CID 67549579) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is 1-fluoro-2,3-dihydro-1H-inden-2-amine.
Molecular Properties
| Compound Name | 1-fluoro-2,3-dihydro-1H-inden-2-amine |
| PubChem CID | 67549579 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 1-fluoro-2,3-dihydro-1H-inden-2-amine |
| SMILES | NC1Cc2ccccc2C1F |
| InChI | InChI=1S/C9H10FN/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9H,5,11H2 |
| InChIKey | HERCDUGUQUZBFE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-2,3-dihydro-1H-inden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,3-dihydro-1H-inden-2-amine?
The IUPAC name of 1-fluoro-2,3-dihydro-1H-inden-2-amine (CID 67549579) is 1-fluoro-2,3-dihydro-1H-inden-2-amine.
What is the SMILES notation for 1-fluoro-2,3-dihydro-1H-inden-2-amine?
The canonical SMILES for 1-fluoro-2,3-dihydro-1H-inden-2-amine is NC1Cc2ccccc2C1F.
What is the InChIKey of 1-fluoro-2,3-dihydro-1H-inden-2-amine?
The InChIKey is HERCDUGUQUZBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9H,5,11H2.
What are the key properties of 1-fluoro-2,3-dihydro-1H-inden-2-amine?
1-fluoro-2,3-dihydro-1H-inden-2-amine has a molecular weight of 151.18 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,3-dihydro-1H-inden-2-amine is sourced from PubChem (CID 67549579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).