About 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol
4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol (PubChem CID 67549873) has the molecular formula C33H28O5S
and a molecular weight of 536.60 g/mol. Its IUPAC name is 4-[3,5-bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol.
Molecular Properties
| Compound Name | 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol |
| PubChem CID | 67549873 |
| Molecular Formula | C33H28O5S |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-[3,5-bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol |
| SMILES | CC1=C(C=CC(=C1)SC2=CC(=CC(=C2)C#CC3=CC(=C(C=C3)OC)OC)C#CC4=CC(=C(C=C4)OC)OC)O |
| InChI | InChI=1S/C33H28O5S/c1-22-16-27(12-13-29(22)34)39-28-18-25(8-6-23-10-14-30(35-2)32(20-23)37-4)17-26(19-28)9-7-24-11-15-31(36-3)33(21-24)38-5/h10-21,34H,1-5H3 |
| InChIKey | ZTQRXKLZCTXHJK-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | 839 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol?
The IUPAC name of 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol (CID 67549873) is 4-[3,5-bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol.
What is the SMILES notation for 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol?
The canonical SMILES for 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol is CC1=C(C=CC(=C1)SC2=CC(=CC(=C2)C#CC3=CC(=C(C=C3)OC)OC)C#CC4=CC(=C(C=C4)OC)OC)O.
What is the InChIKey of 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol?
The InChIKey is ZTQRXKLZCTXHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H28O5S/c1-22-16-27(12-13-29(22)34)39-28-18-25(8-6-23-10-14-30(35-2)32(20-23)37-4)17-26(19-28)9-7-24-11-15-31(36-3)33(21-24)38-5/h10-21,34H,1-5H3.
What are the key properties of 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol?
4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol has a molecular weight of 536.60 g/mol, XLogP of 7.90, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-Bis[2-(3,4-dimethoxyphenyl)ethynyl]phenyl]sulfanyl-2-methylphenol is sourced from PubChem (CID 67549873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).