About 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one
7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one (PubChem CID 675503) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one.
Molecular Properties
| Compound Name | 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one |
| PubChem CID | 675503 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one |
| SMILES | Cc1noc(C)c1COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C15H13NO4/c1-9-13(10(2)20-16-9)8-18-12-5-3-11-4-6-15(17)19-14(11)7-12/h3-7H,8H2,1-2H3 |
| InChIKey | MSXDLPJTYVZYDB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one?
The IUPAC name of 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one (CID 675503) is 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one.
What is the SMILES notation for 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one?
The canonical SMILES for 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one is Cc1noc(C)c1COc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one?
The InChIKey is MSXDLPJTYVZYDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-9-13(10(2)20-16-9)8-18-12-5-3-11-4-6-15(17)19-14(11)7-12/h3-7H,8H2,1-2H3.
What are the key properties of 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one?
7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one has a molecular weight of 271.27 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]chromen-2-one is sourced from PubChem (CID 675503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).