About 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one
6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one (PubChem CID 67550534) has the molecular formula C31H29NO3
and a molecular weight of 463.58 g/mol. Its IUPAC name is 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one.
Molecular Properties
| Compound Name | 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one |
| PubChem CID | 67550534 |
| Molecular Formula | C31H29NO3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one |
| SMILES | CCc1cc(C2(c3ccc(O)c(CC)c3)C(=O)Nc3cc(Cc4ccccc4)ccc32)ccc1O |
| InChI | InChI=1S/C31H29NO3/c1-3-22-18-24(11-14-28(22)33)31(25-12-15-29(34)23(4-2)19-25)26-13-10-21(17-27(26)32-30(31)35)16-20-8-6-5-7-9-20/h5-15,17-19,33-34H,3-4,16H2,1-2H3,(H,32,35) |
| InChIKey | BNDHOWHSLCFOMX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one?
The IUPAC name of 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one (CID 67550534) is 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one.
What is the SMILES notation for 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one?
The canonical SMILES for 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one is CCc1cc(C2(c3ccc(O)c(CC)c3)C(=O)Nc3cc(Cc4ccccc4)ccc32)ccc1O.
What is the InChIKey of 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one?
The InChIKey is BNDHOWHSLCFOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29NO3/c1-3-22-18-24(11-14-28(22)33)31(25-12-15-29(34)23(4-2)19-25)26-13-10-21(17-27(26)32-30(31)35)16-20-8-6-5-7-9-20/h5-15,17-19,33-34H,3-4,16H2,1-2H3,(H,32,35).
What are the key properties of 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one?
6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one has a molecular weight of 463.58 g/mol, XLogP of 6.10, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3,3-bis(3-ethyl-4-hydroxyphenyl)-1H-indol-2-one is sourced from PubChem (CID 67550534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).