About 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate
2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate (PubChem CID 67550687) has the molecular formula C25H25F3N2O3Si
and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate |
| PubChem CID | 67550687 |
| Molecular Formula | C25H25F3N2O3Si |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate |
| SMILES | C[Si](C)(C)CCOC(=O)c1ccc(NC(=O)c2cnccc2C(F)(F)F)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H25F3N2O3Si/c1-34(2,3)14-13-33-24(32)19-10-9-18(15-20(19)17-7-5-4-6-8-17)30-23(31)21-16-29-12-11-22(21)25(26,27)28/h4-12,15-16H,13-14H2,1-3H3,(H,30,31) |
| InChIKey | UVWLHADEMSJVDK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate?
The IUPAC name of 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate (CID 67550687) is 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate.
What is the SMILES notation for 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate?
The canonical SMILES for 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate is C[Si](C)(C)CCOC(=O)c1ccc(NC(=O)c2cnccc2C(F)(F)F)cc1-c1ccccc1.
What is the InChIKey of 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate?
The InChIKey is UVWLHADEMSJVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F3N2O3Si/c1-34(2,3)14-13-33-24(32)19-10-9-18(15-20(19)17-7-5-4-6-8-17)30-23(31)21-16-29-12-11-22(21)25(26,27)28/h4-12,15-16H,13-14H2,1-3H3,(H,30,31).
What are the key properties of 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate?
2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate has a molecular weight of 486.57 g/mol, XLogP of 6.51, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-phenyl-4-[[4-(trifluoromethyl)pyridine-3-carbonyl]amino]benzoate is sourced from PubChem (CID 67550687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).