C28H32N6O9 — CID 67550907
(4S)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67550907) has the molecular formula C28H32N6O9 and a molecular weight of 596.60 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67550907 |
| Molecular Formula | C28H32N6O9 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | (4S)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(NC(=O)CNCc3ncc[nH]3)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C28H32N6O9/c1-10-11-4-5-12(33-14(35)9-30-8-13-31-6-7-32-13)21(36)16(11)22(37)17-15(10)23(38)19-20(34(2)3)24(39)18(27(29)42)26(41)28(19,43)25(17)40/h4-7,10,15,19-20,23,30,36-38,41,43H,8-9H2,1-3H3,(H2,29,42)(H,31,32)(H,33,35)/t10?,15?,19?,20-,23?,28?/m0/s1 |
| InChIKey | YMTCLUBSSWATRV-XYVADANISA-N |
| XLogP | -1.05 |
| TPSA | 251.43 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|