C32H30Cl2N4O8 — CID 67551023
[4-[[(4S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxo-4-phenylbutyl] 2,6-dichlorobenzoate (PubChem CID 67551023) has the molecular formula C32H30Cl2N4O8 and a molecular weight of 669.52 g/mol. Its IUPAC name is [4-[[(4S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxo-4-phenylbutyl] 2,6-dichlorobenzoate.
| Compound Name | [4-[[(4S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxo-4-phenylbutyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 67551023 |
| Molecular Formula | C32H30Cl2N4O8 |
| Molecular Weight | 669.52 g/mol |
| Exact Mass | 668.14 |
| IUPAC Name | [4-[[(4S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxo-4-phenylbutyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)CC(NC(=O)[C@@H]1CCCN2C(=O)CCC(NC(=O)c3ccco3)C(=O)N12)c1ccccc1 |
| InChI | InChI=1S/C32H30Cl2N4O8/c33-21-9-4-10-22(34)28(21)32(44)46-18-20(39)17-24(19-7-2-1-3-8-19)36-29(41)25-11-5-15-37-27(40)14-13-23(31(43)38(25)37)35-30(42)26-12-6-16-45-26/h1-4,6-10,12,16,23-25H,5,11,13-15,17-18H2,(H,35,42)(H,36,41)/t23?,24?,25-/m0/s1 |
| InChIKey | DBFAWEQKNXELQU-STEQJIOHSA-N |
| XLogP | 3.89 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |