About 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide
7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide (PubChem CID 67551476) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide.
Molecular Properties
| Compound Name | 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide |
| PubChem CID | 67551476 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide |
| SMILES | NC(=O)c1c[nH]c2ccsc2c1=O |
| InChI | InChI=1S/C8H6N2O2S/c9-8(12)4-3-10-5-1-2-13-7(5)6(4)11/h1-3H,(H2,9,12)(H,10,11) |
| InChIKey | JMTXZBYRDUJZBI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide?
The IUPAC name of 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide (CID 67551476) is 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide.
What is the SMILES notation for 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide?
The canonical SMILES for 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide is NC(=O)c1c[nH]c2ccsc2c1=O.
What is the InChIKey of 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide?
The InChIKey is JMTXZBYRDUJZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c9-8(12)4-3-10-5-1-2-13-7(5)6(4)11/h1-3H,(H2,9,12)(H,10,11).
What are the key properties of 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide?
7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide has a molecular weight of 194.22 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxamide is sourced from PubChem (CID 67551476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).