C23H25N3O2S — CID 67552359
2-(4-piperazin-1-ylnaphthalen-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline (PubChem CID 67552359) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-(4-piperazin-1-ylnaphthalen-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-(4-piperazin-1-ylnaphthalen-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 67552359 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(4-piperazin-1-ylnaphthalen-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline |
| SMILES | O=S(=O)(c1ccc(N2CCNCC2)c2ccccc12)C1CCc2ccccc2N1 |
| InChI | InChI=1S/C23H25N3O2S/c27-29(28,23-12-9-17-5-1-4-8-20(17)25-23)22-11-10-21(26-15-13-24-14-16-26)18-6-2-3-7-19(18)22/h1-8,10-11,23-25H,9,12-16H2 |
| InChIKey | TXXZBBLFASGHFT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |