C23H30O3 — CID 67553081
6-(hydroxymethyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67553081) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 6-(hydroxymethyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-(hydroxymethyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67553081 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-(hydroxymethyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | Cc1cc2c(cc1C1(C(=O)O)C=CC=CC1CO)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H30O3/c1-15-12-18-19(22(4,5)11-10-21(18,2)3)13-17(15)23(20(25)26)9-7-6-8-16(23)14-24/h6-9,12-13,16,24H,10-11,14H2,1-5H3,(H,25,26) |
| InChIKey | FYFDVCLITBFAAH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |