C47H58N4O6 — CID 67553141
ethyl 5-[11-(4,4-diphenylpiperidin-1-yl)-2-(1-ethoxyethylideneamino)-6-methyl-4-(3-nitrophenyl)undecanoyl]pyridine-3-carboxylate (PubChem CID 67553141) has the molecular formula C47H58N4O6 and a molecular weight of 775.00 g/mol. Its IUPAC name is ethyl 5-[11-(4,4-diphenylpiperidin-1-yl)-2-(1-ethoxyethylideneamino)-6-methyl-4-(3-nitrophenyl)undecanoyl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[11-(4,4-diphenylpiperidin-1-yl)-2-(1-ethoxyethylideneamino)-6-methyl-4-(3-nitrophenyl)undecanoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67553141 |
| Molecular Formula | C47H58N4O6 |
| Molecular Weight | 775.00 g/mol |
| Exact Mass | 774.44 |
| IUPAC Name | ethyl 5-[11-(4,4-diphenylpiperidin-1-yl)-2-(1-ethoxyethylideneamino)-6-methyl-4-(3-nitrophenyl)undecanoyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(C(=O)C(CC(CC(C)CCCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)c2cccc([N+](=O)[O-])c2)/N=C(\C)OCC)c1 |
| InChI | InChI=1S/C47H58N4O6/c1-5-56-36(4)49-44(45(52)39-30-40(34-48-33-39)46(53)57-6-2)32-38(37-18-16-23-43(31-37)51(54)55)29-35(3)17-10-9-15-26-50-27-24-47(25-28-50,41-19-11-7-12-20-41)42-21-13-8-14-22-42/h7-8,11-14,16,18-23,30-31,33-35,38,44H,5-6,9-10,15,17,24-29,32H2,1-4H3/b49-36+ |
| InChIKey | OGTWWLUZKYHDOL-LDOIFQDASA-N |
| XLogP | 10.02 |
| TPSA | 124.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.00 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|