About 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline
1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline (PubChem CID 67553271) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline |
| PubChem CID | 67553271 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline |
| SMILES | CCc1cccc(N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C17H19N/c1-2-14-7-5-10-16(13-14)18-12-6-9-15-8-3-4-11-17(15)18/h3-5,7-8,10-11,13H,2,6,9,12H2,1H3 |
| InChIKey | VIHQTWDEVWVFSU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline (CID 67553271) is 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline is CCc1cccc(N2CCCc3ccccc32)c1.
What is the InChIKey of 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline?
The InChIKey is VIHQTWDEVWVFSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-2-14-7-5-10-16(13-14)18-12-6-9-15-8-3-4-11-17(15)18/h3-5,7-8,10-11,13H,2,6,9,12H2,1H3.
What are the key properties of 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline?
1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline has a molecular weight of 237.35 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylphenyl)-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 67553271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).