C21H14F3NO3 — CID 67553915
(2,3,4-trifluorophenyl) 1-methoxy-9,10-dihydroacridine-9-carboxylate (PubChem CID 67553915) has the molecular formula C21H14F3NO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is (2,3,4-trifluorophenyl) 1-methoxy-9,10-dihydroacridine-9-carboxylate.
| Compound Name | (2,3,4-trifluorophenyl) 1-methoxy-9,10-dihydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 67553915 |
| Molecular Formula | C21H14F3NO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (2,3,4-trifluorophenyl) 1-methoxy-9,10-dihydroacridine-9-carboxylate |
| SMILES | COc1cccc2c1C(C(=O)Oc1ccc(F)c(F)c1F)c1ccccc1N2 |
| InChI | InChI=1S/C21H14F3NO3/c1-27-15-8-4-7-14-18(15)17(11-5-2-3-6-13(11)25-14)21(26)28-16-10-9-12(22)19(23)20(16)24/h2-10,17,25H,1H3 |
| InChIKey | YSOVSJPGLKVWSQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|