C33H43N5O6S — CID 67554042
2-[[2-[[4-methyl-2-[2-(4-nitrophenyl)ethylcarbamoylamino]pentyl]-(naphthalen-1-ylmethyl)amino]acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 67554042) has the molecular formula C33H43N5O6S and a molecular weight of 637.80 g/mol. Its IUPAC name is 2-[[2-[[4-methyl-2-[2-(4-nitrophenyl)ethylcarbamoylamino]pentyl]-(naphthalen-1-ylmethyl)amino]acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[4-methyl-2-[2-(4-nitrophenyl)ethylcarbamoylamino]pentyl]-(naphthalen-1-ylmethyl)amino]acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 67554042 |
| Molecular Formula | C33H43N5O6S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 2-[[2-[[4-methyl-2-[2-(4-nitrophenyl)ethylcarbamoylamino]pentyl]-(naphthalen-1-ylmethyl)amino]acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)CN(Cc1cccc2ccccc12)CC(CC(C)C)NC(=O)NCCc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C33H43N5O6S/c1-23(2)19-27(35-33(42)34-17-15-24-11-13-28(14-12-24)38(43)44)21-37(22-31(39)36-30(32(40)41)16-18-45-3)20-26-9-6-8-25-7-4-5-10-29(25)26/h4-14,23,27,30H,15-22H2,1-3H3,(H,36,39)(H,40,41)(H2,34,35,42) |
| InChIKey | GSZCLWMPEKGLPZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|