About 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine
1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine (PubChem CID 67554480) has the molecular formula C26H24N6
and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine.
Molecular Properties
| Compound Name | 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine |
| PubChem CID | 67554480 |
| Molecular Formula | C26H24N6 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine |
| SMILES | [H]/N=C(\N)N(/C(=N/[H])N(c1ccccc1)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24N6/c27-25(28)32(31(23-17-9-3-10-18-23)24-19-11-4-12-20-24)26(29)30(21-13-5-1-6-14-21)22-15-7-2-8-16-22/h1-20,29H,(H3,27,28)/b29-26+ |
| InChIKey | YZEYZMOGNLRHNV-PBBVDAKRSA-N |
| XLogP | 5.71 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine?
The IUPAC name of 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine (CID 67554480) is 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine.
What is the SMILES notation for 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine?
The canonical SMILES for 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine is [H]/N=C(\N)N(/C(=N/[H])N(c1ccccc1)c1ccccc1)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine?
The InChIKey is YZEYZMOGNLRHNV-PBBVDAKRSA-N. The full InChI is InChI=1S/C26H24N6/c27-25(28)32(31(23-17-9-3-10-18-23)24-19-11-4-12-20-24)26(29)30(21-13-5-1-6-14-21)22-15-7-2-8-16-22/h1-20,29H,(H3,27,28)/b29-26+.
What are the key properties of 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine?
1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine has a molecular weight of 420.52 g/mol, XLogP of 5.71, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-3,3-diphenyl-1-(N-phenylanilino)guanidine is sourced from PubChem (CID 67554480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).