About 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine
3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine (PubChem CID 67554574) has the molecular formula C22H27FN2O2
and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine.
Molecular Properties
| Compound Name | 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine |
| PubChem CID | 67554574 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCNC(C(C)C3OCCc4cc(F)ccc43)C2)cc1 |
| InChI | InChI=1S/C22H27FN2O2/c1-15(22-20-8-3-17(23)13-16(20)9-12-27-22)21-14-25(11-10-24-21)18-4-6-19(26-2)7-5-18/h3-8,13,15,21-22,24H,9-12,14H2,1-2H3 |
| InChIKey | ARSCCCLQQIREAO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine?
The IUPAC name of 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine (CID 67554574) is 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine.
What is the SMILES notation for 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine?
The canonical SMILES for 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine is COc1ccc(N2CCNC(C(C)C3OCCc4cc(F)ccc43)C2)cc1.
What is the InChIKey of 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine?
The InChIKey is ARSCCCLQQIREAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27FN2O2/c1-15(22-20-8-3-17(23)13-16(20)9-12-27-22)21-14-25(11-10-24-21)18-4-6-19(26-2)7-5-18/h3-8,13,15,21-22,24H,9-12,14H2,1-2H3.
What are the key properties of 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine?
3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine has a molecular weight of 370.47 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-methoxyphenyl)piperazine is sourced from PubChem (CID 67554574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).