C26H25N3O4S — CID 67554948
4-[(3,4-dimethoxyphenyl)methylamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)benzoic acid (PubChem CID 67554948) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methylamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)benzoic acid.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methylamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 67554948 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methylamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)benzoic acid |
| SMILES | COc1ccc(CNc2ccc(C(=O)O)c(-c3ncc4c5c(sc4n3)CCCC5)c2)cc1OC |
| InChI | InChI=1S/C26H25N3O4S/c1-32-21-10-7-15(11-22(21)33-2)13-27-16-8-9-18(26(30)31)19(12-16)24-28-14-20-17-5-3-4-6-23(17)34-25(20)29-24/h7-12,14,27H,3-6,13H2,1-2H3,(H,30,31) |
| InChIKey | GOCCYVYXNPMEJV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |