About (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol
(Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol (PubChem CID 67554986) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol.
Molecular Properties
| Compound Name | (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol |
| PubChem CID | 67554986 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol |
| SMILES | C/C=C(/C)C(C(C)CCC(N)O)C1C=CCCC1 |
| InChI | InChI=1S/C16H29NO/c1-4-12(2)16(13(3)10-11-15(17)18)14-8-6-5-7-9-14/h4,6,8,13-16,18H,5,7,9-11,17H2,1-3H3/b12-4- |
| InChIKey | QAAWHDMGAIQSAD-QCDXTXTGSA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol?
The IUPAC name of (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol (CID 67554986) is (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol.
What is the SMILES notation for (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol?
The canonical SMILES for (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol is C/C=C(/C)C(C(C)CCC(N)O)C1C=CCCC1.
What is the InChIKey of (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol?
The InChIKey is QAAWHDMGAIQSAD-QCDXTXTGSA-N. The full InChI is InChI=1S/C16H29NO/c1-4-12(2)16(13(3)10-11-15(17)18)14-8-6-5-7-9-14/h4,6,8,13-16,18H,5,7,9-11,17H2,1-3H3/b12-4-.
What are the key properties of (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol?
(Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol has a molecular weight of 251.41 g/mol, XLogP of 3.62, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-amino-5-cyclohex-2-en-1-yl-4,6-dimethyloct-6-en-1-ol is sourced from PubChem (CID 67554986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).