About 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine
3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine (PubChem CID 67555081) has the molecular formula C24H32N2O2
and a molecular weight of 380.53 g/mol. Its IUPAC name is 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine.
Molecular Properties
| Compound Name | 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine |
| PubChem CID | 67555081 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine |
| SMILES | CC(C)Oc1ccc(N2CCNC(CCC3OCCc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-18(2)28-22-10-8-21(9-11-22)26-15-14-25-20(17-26)7-12-24-23-6-4-3-5-19(23)13-16-27-24/h3-6,8-11,18,20,24-25H,7,12-17H2,1-2H3 |
| InChIKey | PMDCTLSOAZCQJC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine?
The IUPAC name of 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine (CID 67555081) is 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine.
What is the SMILES notation for 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine?
The canonical SMILES for 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine is CC(C)Oc1ccc(N2CCNC(CCC3OCCc4ccccc43)C2)cc1.
What is the InChIKey of 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine?
The InChIKey is PMDCTLSOAZCQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O2/c1-18(2)28-22-10-8-21(9-11-22)26-15-14-25-20(17-26)7-12-24-23-6-4-3-5-19(23)13-16-27-24/h3-6,8-11,18,20,24-25H,7,12-17H2,1-2H3.
What are the key properties of 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine?
3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine has a molecular weight of 380.53 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]-1-(4-propan-2-yloxyphenyl)piperazine is sourced from PubChem (CID 67555081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).