About 2-phenyl-4-propan-2-yl-1,3-dioxetane
2-phenyl-4-propan-2-yl-1,3-dioxetane (PubChem CID 67555130) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-phenyl-4-propan-2-yl-1,3-dioxetane.
Molecular Properties
| Compound Name | 2-phenyl-4-propan-2-yl-1,3-dioxetane |
| PubChem CID | 67555130 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-phenyl-4-propan-2-yl-1,3-dioxetane |
| SMILES | CC(C)C1OC(c2ccccc2)O1 |
| InChI | InChI=1S/C11H14O2/c1-8(2)10-12-11(13-10)9-6-4-3-5-7-9/h3-8,10-11H,1-2H3 |
| InChIKey | GGLQAXBTDQXRAQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-4-propan-2-yl-1,3-dioxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-propan-2-yl-1,3-dioxetane?
The IUPAC name of 2-phenyl-4-propan-2-yl-1,3-dioxetane (CID 67555130) is 2-phenyl-4-propan-2-yl-1,3-dioxetane.
What is the SMILES notation for 2-phenyl-4-propan-2-yl-1,3-dioxetane?
The canonical SMILES for 2-phenyl-4-propan-2-yl-1,3-dioxetane is CC(C)C1OC(c2ccccc2)O1.
What is the InChIKey of 2-phenyl-4-propan-2-yl-1,3-dioxetane?
The InChIKey is GGLQAXBTDQXRAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-8(2)10-12-11(13-10)9-6-4-3-5-7-9/h3-8,10-11H,1-2H3.
What are the key properties of 2-phenyl-4-propan-2-yl-1,3-dioxetane?
2-phenyl-4-propan-2-yl-1,3-dioxetane has a molecular weight of 178.23 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-propan-2-yl-1,3-dioxetane is sourced from PubChem (CID 67555130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).