About 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one
6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one (PubChem CID 67555557) has the molecular formula C10H12O3S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one.
Molecular Properties
| Compound Name | 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one |
| PubChem CID | 67555557 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one |
| SMILES | CC1C=C2C(=O)CS(=O)(=O)CC2=CC1 |
| InChI | InChI=1S/C10H12O3S/c1-7-2-3-8-5-14(12,13)6-10(11)9(8)4-7/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | FTGJPYRIQNTULP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one?
The IUPAC name of 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one (CID 67555557) is 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one.
What is the SMILES notation for 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one?
The canonical SMILES for 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one is CC1C=C2C(=O)CS(=O)(=O)CC2=CC1.
What is the InChIKey of 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one?
The InChIKey is FTGJPYRIQNTULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c1-7-2-3-8-5-14(12,13)6-10(11)9(8)4-7/h3-4,7H,2,5-6H2,1H3.
What are the key properties of 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one?
6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one has a molecular weight of 212.27 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,2-dioxo-6,7-dihydro-1H-isothiochromen-4-one is sourced from PubChem (CID 67555557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).