C12H16BrNO2 — CID 67555588
5-bromo-2-(3-methylbutoxy)benzamide (PubChem CID 67555588) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 67555588 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(N)=O |
| InChI | InChI=1S/C12H16BrNO2/c1-8(2)5-6-16-11-4-3-9(13)7-10(11)12(14)15/h3-4,7-8H,5-6H2,1-2H3,(H2,14,15) |
| InChIKey | FVHXTIJRRPBBQI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |