C20H25NO6S — CID 67555928
diethyl 2-[1-(2-methyl-1,3-benzothiazol-5-yl)-2-(4-methyl-1,3-dioxetan-2-yl)ethyl]propanedioate (PubChem CID 67555928) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is diethyl 2-[1-(2-methyl-1,3-benzothiazol-5-yl)-2-(4-methyl-1,3-dioxetan-2-yl)ethyl]propanedioate.
| Compound Name | diethyl 2-[1-(2-methyl-1,3-benzothiazol-5-yl)-2-(4-methyl-1,3-dioxetan-2-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 67555928 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | diethyl 2-[1-(2-methyl-1,3-benzothiazol-5-yl)-2-(4-methyl-1,3-dioxetan-2-yl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC1OC(C)O1)c1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C20H25NO6S/c1-5-24-19(22)18(20(23)25-6-2)14(10-17-26-12(4)27-17)13-7-8-16-15(9-13)21-11(3)28-16/h7-9,12,14,17-18H,5-6,10H2,1-4H3 |
| InChIKey | BSQHKELHIWMWQJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|