C20H20F2N2O3 — CID 67555992
3-amino-2-[4-(4-fluorophenyl)phenyl]-4-[(3S)-3-fluoropyrrolidin-1-yl]-4-oxobutanoic acid (PubChem CID 67555992) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-amino-2-[4-(4-fluorophenyl)phenyl]-4-[(3S)-3-fluoropyrrolidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 3-amino-2-[4-(4-fluorophenyl)phenyl]-4-[(3S)-3-fluoropyrrolidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67555992 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-amino-2-[4-(4-fluorophenyl)phenyl]-4-[(3S)-3-fluoropyrrolidin-1-yl]-4-oxobutanoic acid |
| SMILES | NC(C(=O)N1CC[C@H](F)C1)C(C(=O)O)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H20F2N2O3/c21-15-7-5-13(6-8-15)12-1-3-14(4-2-12)17(20(26)27)18(23)19(25)24-10-9-16(22)11-24/h1-8,16-18H,9-11,23H2,(H,26,27)/t16-,17?,18?/m0/s1 |
| InChIKey | DTKVWZHRUMDYLF-AOCRQIFASA-N |
| XLogP | 2.56 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |