C14H23N — CID 67556456
1-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 67556456) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)piperidine.
| Compound Name | 1-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 67556456 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | CC1=CC(C)(C)CC(N2CCCCC2)=C1 |
| InChI | InChI=1S/C14H23N/c1-12-9-13(11-14(2,3)10-12)15-7-5-4-6-8-15/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | HKWWRHZRFCKLBO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |