C8H8N2O2S — CID 67557929
3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 67557929) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is 3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67557929 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1cc2c(=O)n(C)c(=O)[nH]c2s1 |
| InChI | InChI=1S/C8H8N2O2S/c1-4-3-5-6(13-4)9-8(12)10(2)7(5)11/h3H,1-2H3,(H,9,12) |
| InChIKey | YKMPYSYKCPCGAH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |