About 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid
2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid (PubChem CID 67557933) has the molecular formula C28H28N2O7S
and a molecular weight of 536.61 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid |
| PubChem CID | 67557933 |
| Molecular Formula | C28H28N2O7S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCC(=O)O)cccc12.O=C(O)CCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H16N2O4S.C14H12O3/c1-16(2)12-7-3-6-11-10(12)5-4-8-13(11)21(19,20)15-9-14(17)18;15-13(7-8-14(16)17)12-6-5-10-3-1-2-4-11(10)9-12/h3-8,15H,9H2,1-2H3,(H,17,18);1-6,9H,7-8H2,(H,16,17) |
| InChIKey | WQXRNXYSGDAUOT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid?
The IUPAC name of 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid (CID 67557933) is 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid.
What is the SMILES notation for 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid?
The canonical SMILES for 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid is CN(C)c1cccc2c(S(=O)(=O)NCC(=O)O)cccc12.O=C(O)CCC(=O)c1ccc2ccccc2c1.
What is the InChIKey of 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid?
The InChIKey is WQXRNXYSGDAUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4S.C14H12O3/c1-16(2)12-7-3-6-11-10(12)5-4-8-13(11)21(19,20)15-9-14(17)18;15-13(7-8-14(16)17)12-6-5-10-3-1-2-4-11(10)9-12/h3-8,15H,9H2,1-2H3,(H,17,18);1-6,9H,7-8H2,(H,16,17).
What are the key properties of 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid?
2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid has a molecular weight of 536.61 g/mol, XLogP of 4.16, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetic acid;4-naphthalen-2-yl-4-oxobutanoic acid is sourced from PubChem (CID 67557933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).