C9H8F3NaO2P+ — CID 67558110
sodium oxido-oxo-(5,5,6-trifluoro-6-prop-1-enylcyclohexa-1,3-dien-1-yl)phosphanium (PubChem CID 67558110) has the molecular formula C9H8F3NaO2P+ and a molecular weight of 259.12 g/mol. Its IUPAC name is sodium oxido-oxo-(5,5,6-trifluoro-6-prop-1-enylcyclohexa-1,3-dien-1-yl)phosphanium.
| Compound Name | sodium oxido-oxo-(5,5,6-trifluoro-6-prop-1-enylcyclohexa-1,3-dien-1-yl)phosphanium |
|---|---|
| PubChem CID | 67558110 |
| Molecular Formula | C9H8F3NaO2P+ |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | sodium oxido-oxo-(5,5,6-trifluoro-6-prop-1-enylcyclohexa-1,3-dien-1-yl)phosphanium |
| SMILES | CC=CC1(F)C([P+](=O)[O-])=CC=CC1(F)F.[Na+] |
| InChI | InChI=1S/C9H8F3O2P.Na/c1-2-5-8(10)7(15(13)14)4-3-6-9(8,11)12;/h2-6H,1H3;/q;+1 |
| InChIKey | GIZDQYQJFOMNOZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|