C18H18FNO2S — CID 67558227
N-[2-(4-fluorophenyl)cyclopenten-1-yl]-N-methylbenzenesulfonamide (PubChem CID 67558227) has the molecular formula C18H18FNO2S and a molecular weight of 331.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)cyclopenten-1-yl]-N-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)cyclopenten-1-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67558227 |
| Molecular Formula | C18H18FNO2S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)cyclopenten-1-yl]-N-methylbenzenesulfonamide |
| SMILES | CN(C1=C(c2ccc(F)cc2)CCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO2S/c1-20(23(21,22)16-6-3-2-4-7-16)18-9-5-8-17(18)14-10-12-15(19)13-11-14/h2-4,6-7,10-13H,5,8-9H2,1H3 |
| InChIKey | IYEVZSWQRHPNSZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |