About N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide
N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide (PubChem CID 67558352) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide |
| PubChem CID | 67558352 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide |
| SMILES | CC(NC(=O)C(C)(C)C)=C1C=CC=C1 |
| InChI | InChI=1S/C12H17NO/c1-9(10-7-5-6-8-10)13-11(14)12(2,3)4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | YLOJUKIGVPZEJC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide (CID 67558352) is N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide is CC(NC(=O)C(C)(C)C)=C1C=CC=C1.
What is the InChIKey of N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide?
The InChIKey is YLOJUKIGVPZEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(10-7-5-6-8-10)13-11(14)12(2,3)4/h5-8H,1-4H3,(H,13,14).
What are the key properties of N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide?
N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide has a molecular weight of 191.27 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 67558352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).