About CID 67558397
CID 67558397 (PubChem CID 67558397) has the molecular formula C6H14BN2O
and a molecular weight of 141.00 g/mol.
Molecular Properties
| Compound Name | CID 67558397 |
| PubChem CID | 67558397 |
| Molecular Formula | C6H14BN2O |
| Molecular Weight | 141.00 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | — |
| SMILES | CO[B]N1CCC(N)CC1 |
| InChI | InChI=1S/C6H14BN2O/c1-10-7-9-4-2-6(8)3-5-9/h6H,2-5,8H2,1H3 |
| InChIKey | GFMKCHANNZRPPU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.00 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67558397 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67558397?
The IUPAC name of CID 67558397 (CID 67558397) is not available.
What is the SMILES notation for CID 67558397?
The canonical SMILES for CID 67558397 is CO[B]N1CCC(N)CC1.
What is the InChIKey of CID 67558397?
The InChIKey is GFMKCHANNZRPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14BN2O/c1-10-7-9-4-2-6(8)3-5-9/h6H,2-5,8H2,1H3.
What are the key properties of CID 67558397?
CID 67558397 has a molecular weight of 141.00 g/mol, XLogP of -0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67558397 is sourced from PubChem (CID 67558397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).