C22H27FN2O7 — CID 67558716
(E)-but-2-enedioic acid;3-[1-(2-ethyl-1,3-dioxan-2-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole (PubChem CID 67558716) has the molecular formula C22H27FN2O7 and a molecular weight of 450.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[1-(2-ethyl-1,3-dioxan-2-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole.
| Compound Name | (E)-but-2-enedioic acid;3-[1-(2-ethyl-1,3-dioxan-2-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 67558716 |
| Molecular Formula | C22H27FN2O7 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[1-(2-ethyl-1,3-dioxan-2-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
| SMILES | CCC1(N2CCC(c3noc4cc(F)ccc34)CC2)OCCCO1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H23FN2O3.C4H4O4/c1-2-18(22-10-3-11-23-18)21-8-6-13(7-9-21)17-15-5-4-14(19)12-16(15)24-20-17;5-3(6)1-2-4(7)8/h4-5,12-13H,2-3,6-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CMZJVCHKKBBURB-WLHGVMLRSA-N |
| XLogP | 3.36 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|