About 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile
2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile (PubChem CID 67558959) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile |
| PubChem CID | 67558959 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile |
| SMILES | N#CCC1C[C@H]2CC[C@H]2C1 |
| InChI | InChI=1S/C9H13N/c10-4-3-7-5-8-1-2-9(8)6-7/h7-9H,1-3,5-6H2/t7?,8-,9+ |
| InChIKey | MLNKANRZDWZWDU-CBLAIPOGSA-N |
| XLogP | 2.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile?
The IUPAC name of 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile (CID 67558959) is 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile.
What is the SMILES notation for 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile?
The canonical SMILES for 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile is N#CCC1C[C@H]2CC[C@H]2C1.
What is the InChIKey of 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile?
The InChIKey is MLNKANRZDWZWDU-CBLAIPOGSA-N. The full InChI is InChI=1S/C9H13N/c10-4-3-7-5-8-1-2-9(8)6-7/h7-9H,1-3,5-6H2/t7?,8-,9+.
What are the key properties of 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile?
2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile has a molecular weight of 135.21 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-3-bicyclo[3.2.0]heptanyl]acetonitrile is sourced from PubChem (CID 67558959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).