C29H41F3N2O3S — CID 67559504
(10E,13E)-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-2-methylidene-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-dien-6-one (PubChem CID 67559504) has the molecular formula C29H41F3N2O3S and a molecular weight of 554.72 g/mol. Its IUPAC name is (10E,13E)-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-2-methylidene-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-dien-6-one.
| Compound Name | (10E,13E)-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-2-methylidene-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-dien-6-one |
|---|---|
| PubChem CID | 67559504 |
| Molecular Formula | C29H41F3N2O3S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | (10E,13E)-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-2-methylidene-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-dien-6-one |
| SMILES | C=C1CCC(C)(C)C(=O)C(C)C(O)C(C)/C=C/C/C(C(F)(F)F)=C\CC(/C(C)=C/c2csc(CNC)n2)O1 |
| InChI | InChI=1S/C29H41F3N2O3S/c1-18-9-8-10-22(29(30,31)32)11-12-24(19(2)15-23-17-38-25(34-23)16-33-7)37-20(3)13-14-28(5,6)27(36)21(4)26(18)35/h8-9,11,15,17-18,21,24,26,33,35H,3,10,12-14,16H2,1-2,4-7H3/b9-8+,19-15+,22-11+ |
| InChIKey | GWQDZUGRZSUOTQ-UCAQZZLHSA-N |
| XLogP | 7.01 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|