About (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane
(3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane (PubChem CID 67559536) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane.
Molecular Properties
| Compound Name | (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane |
| PubChem CID | 67559536 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane |
| SMILES | COC/C=C1/C(C)CCOC1C |
| InChI | InChI=1S/C10H18O2/c1-8-4-7-12-9(2)10(8)5-6-11-3/h5,8-9H,4,6-7H2,1-3H3/b10-5- |
| InChIKey | NNPMEHHTOOVMQS-YHYXMXQVSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane?
The IUPAC name of (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane (CID 67559536) is (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane.
What is the SMILES notation for (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane?
The canonical SMILES for (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane is COC/C=C1/C(C)CCOC1C.
What is the InChIKey of (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane?
The InChIKey is NNPMEHHTOOVMQS-YHYXMXQVSA-N. The full InChI is InChI=1S/C10H18O2/c1-8-4-7-12-9(2)10(8)5-6-11-3/h5,8-9H,4,6-7H2,1-3H3/b10-5-.
What are the key properties of (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane?
(3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane has a molecular weight of 170.25 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(2-methoxyethylidene)-2,4-dimethyloxane is sourced from PubChem (CID 67559536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).