About N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide
N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide (PubChem CID 67559657) has the molecular formula C18H21N3S
and a molecular weight of 311.45 g/mol. Its IUPAC name is N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide.
Molecular Properties
| Compound Name | N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide |
| PubChem CID | 67559657 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide |
| SMILES | CS(C)(C)C#Cc1ccc(/C(N)=N/c2ccccc2N)cc1 |
| InChI | InChI=1S/C18H21N3S/c1-22(2,3)13-12-14-8-10-15(11-9-14)18(20)21-17-7-5-4-6-16(17)19/h4-11H,19H2,1-3H3,(H2,20,21) |
| InChIKey | UBXABMKWLPXZFE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide?
The IUPAC name of N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide (CID 67559657) is N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide.
What is the SMILES notation for N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide?
The canonical SMILES for N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide is CS(C)(C)C#Cc1ccc(/C(N)=N/c2ccccc2N)cc1.
What is the InChIKey of N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide?
The InChIKey is UBXABMKWLPXZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3S/c1-22(2,3)13-12-14-8-10-15(11-9-14)18(20)21-17-7-5-4-6-16(17)19/h4-11H,19H2,1-3H3,(H2,20,21).
What are the key properties of N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide?
N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide has a molecular weight of 311.45 g/mol, XLogP of 3.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminophenyl)-4-[2-(trimethyl-λ4-sulfanyl)ethynyl]benzenecarboximidamide is sourced from PubChem (CID 67559657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).