C7H13N3 — CID 67559797
N'-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)methanimidamide (PubChem CID 67559797) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N'-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)methanimidamide.
| Compound Name | N'-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)methanimidamide |
|---|---|
| PubChem CID | 67559797 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N'-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)methanimidamide |
| SMILES | CC1=C(/N=C/N)CCNC1 |
| InChI | InChI=1S/C7H13N3/c1-6-4-9-3-2-7(6)10-5-8/h5,9H,2-4H2,1H3,(H2,8,10) |
| InChIKey | ANJGWOYXJINPSI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|