C10H13NO — CID 67559825
4-ethyl-1,3,3a,4-tetrahydroindol-2-one (PubChem CID 67559825) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-ethyl-1,3,3a,4-tetrahydroindol-2-one.
| Compound Name | 4-ethyl-1,3,3a,4-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 67559825 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-ethyl-1,3,3a,4-tetrahydroindol-2-one |
| SMILES | CCC1C=CC=C2NC(=O)CC21 |
| InChI | InChI=1S/C10H13NO/c1-2-7-4-3-5-9-8(7)6-10(12)11-9/h3-5,7-8H,2,6H2,1H3,(H,11,12) |
| InChIKey | SLIZUQQSKLIYTG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |