About 3,4-dimethyl-3H-borole
3,4-dimethyl-3H-borole (PubChem CID 67559953) has the molecular formula C6H9B
and a molecular weight of 91.95 g/mol. Its IUPAC name is 3,4-dimethyl-3H-borole.
Molecular Properties
| Compound Name | 3,4-dimethyl-3H-borole |
| PubChem CID | 67559953 |
| Molecular Formula | C6H9B |
| Molecular Weight | 91.95 g/mol |
| Exact Mass | 92.08 |
| IUPAC Name | 3,4-dimethyl-3H-borole |
| SMILES | CC1=CB=CC1C |
| InChI | InChI=1S/C6H9B/c1-5-3-7-4-6(5)2/h3-5H,1-2H3 |
| InChIKey | YQUZNECEBFZBFF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.95 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-3H-borole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-3H-borole?
The IUPAC name of 3,4-dimethyl-3H-borole (CID 67559953) is 3,4-dimethyl-3H-borole.
What is the SMILES notation for 3,4-dimethyl-3H-borole?
The canonical SMILES for 3,4-dimethyl-3H-borole is CC1=CB=CC1C.
What is the InChIKey of 3,4-dimethyl-3H-borole?
The InChIKey is YQUZNECEBFZBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9B/c1-5-3-7-4-6(5)2/h3-5H,1-2H3.
What are the key properties of 3,4-dimethyl-3H-borole?
3,4-dimethyl-3H-borole has a molecular weight of 91.95 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-3H-borole is sourced from PubChem (CID 67559953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).