About 3,3-dimethyl-1,5-benzodiazepine
3,3-dimethyl-1,5-benzodiazepine (PubChem CID 67559989) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 3,3-dimethyl-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 3,3-dimethyl-1,5-benzodiazepine |
| PubChem CID | 67559989 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3,3-dimethyl-1,5-benzodiazepine |
| SMILES | CC1(C)C=Nc2ccccc2N=C1 |
| InChI | InChI=1S/C11H12N2/c1-11(2)7-12-9-5-3-4-6-10(9)13-8-11/h3-8H,1-2H3 |
| InChIKey | DZJQZQKZDNNEBT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1,5-benzodiazepine?
The IUPAC name of 3,3-dimethyl-1,5-benzodiazepine (CID 67559989) is 3,3-dimethyl-1,5-benzodiazepine.
What is the SMILES notation for 3,3-dimethyl-1,5-benzodiazepine?
The canonical SMILES for 3,3-dimethyl-1,5-benzodiazepine is CC1(C)C=Nc2ccccc2N=C1.
What is the InChIKey of 3,3-dimethyl-1,5-benzodiazepine?
The InChIKey is DZJQZQKZDNNEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-11(2)7-12-9-5-3-4-6-10(9)13-8-11/h3-8H,1-2H3.
What are the key properties of 3,3-dimethyl-1,5-benzodiazepine?
3,3-dimethyl-1,5-benzodiazepine has a molecular weight of 172.23 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1,5-benzodiazepine is sourced from PubChem (CID 67559989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).