About 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one
1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one (PubChem CID 67560908) has the molecular formula C21H26FNO3
and a molecular weight of 359.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one |
| PubChem CID | 67560908 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one |
| SMILES | CCC(CCC(C)(F)C(=O)c1ccc2nc3c(cc2c1)CCCO3)OC |
| InChI | InChI=1S/C21H26FNO3/c1-4-17(25-3)9-10-21(2,22)19(24)14-7-8-18-16(12-14)13-15-6-5-11-26-20(15)23-18/h7-8,12-13,17H,4-6,9-11H2,1-3H3 |
| InChIKey | XADLZSQSRAWTEH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one?
The IUPAC name of 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one (CID 67560908) is 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one?
The canonical SMILES for 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one is CCC(CCC(C)(F)C(=O)c1ccc2nc3c(cc2c1)CCCO3)OC.
What is the InChIKey of 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one?
The InChIKey is XADLZSQSRAWTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FNO3/c1-4-17(25-3)9-10-21(2,22)19(24)14-7-8-18-16(12-14)13-15-6-5-11-26-20(15)23-18/h7-8,12-13,17H,4-6,9-11H2,1-3H3.
What are the key properties of 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one?
1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one has a molecular weight of 359.44 g/mol, XLogP of 4.68, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-fluoro-5-methoxy-2-methylheptan-1-one is sourced from PubChem (CID 67560908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).