About 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine
4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine (PubChem CID 67561114) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine |
| PubChem CID | 67561114 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)(N)CC(C)(C)c1ccc(C(C)(C)CC(C)(C)N)cc1 |
| InChI | InChI=1S/C20H36N2/c1-17(2,13-19(5,6)21)15-9-11-16(12-10-15)18(3,4)14-20(7,8)22/h9-12H,13-14,21-22H2,1-8H3 |
| InChIKey | AMQCGZZETSPWEI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine?
The IUPAC name of 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine (CID 67561114) is 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine.
What is the SMILES notation for 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine?
The canonical SMILES for 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine is CC(C)(N)CC(C)(C)c1ccc(C(C)(C)CC(C)(C)N)cc1.
What is the InChIKey of 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine?
The InChIKey is AMQCGZZETSPWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2/c1-17(2,13-19(5,6)21)15-9-11-16(12-10-15)18(3,4)14-20(7,8)22/h9-12H,13-14,21-22H2,1-8H3.
What are the key properties of 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine?
4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine has a molecular weight of 304.52 g/mol, XLogP of 4.50, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-amino-2,4-dimethylpentan-2-yl)phenyl]-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 67561114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).