About 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone
1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone (PubChem CID 67561539) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone |
| PubChem CID | 67561539 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC2(CN1C(C)=O)OCCO2 |
| InChI | InChI=1S/C10H15NO4/c1-7(12)9-5-10(14-3-4-15-10)6-11(9)8(2)13/h9H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | CHXLCHDHIIEQMX-VIFPVBQESA-N |
| XLogP | -0.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone?
The IUPAC name of 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone (CID 67561539) is 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone.
What is the SMILES notation for 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone?
The canonical SMILES for 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone is CC(=O)[C@@H]1CC2(CN1C(C)=O)OCCO2.
What is the InChIKey of 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone?
The InChIKey is CHXLCHDHIIEQMX-VIFPVBQESA-N. The full InChI is InChI=1S/C10H15NO4/c1-7(12)9-5-10(14-3-4-15-10)6-11(9)8(2)13/h9H,3-6H2,1-2H3/t9-/m0/s1.
What are the key properties of 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone?
1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone has a molecular weight of 213.23 g/mol, XLogP of -0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(8S)-7-acetyl-1,4-dioxa-7-azaspiro[4.4]nonan-8-yl]ethanone is sourced from PubChem (CID 67561539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).