C44H69NO9 — CID 67561558
(18E)-1,14-dihydroxy-12-[(E)-1-(4-hydroxy-3-methylcyclohexyl)prop-1-en-2-yl]-13,19,21,23,25,27-hexamethyl-17-prop-2-enyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone (PubChem CID 67561558) has the molecular formula C44H69NO9 and a molecular weight of 756.03 g/mol. Its IUPAC name is (18E)-1,14-dihydroxy-12-[(E)-1-(4-hydroxy-3-methylcyclohexyl)prop-1-en-2-yl]-13,19,21,23,25,27-hexamethyl-17-prop-2-enyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone.
| Compound Name | (18E)-1,14-dihydroxy-12-[(E)-1-(4-hydroxy-3-methylcyclohexyl)prop-1-en-2-yl]-13,19,21,23,25,27-hexamethyl-17-prop-2-enyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
|---|---|
| PubChem CID | 67561558 |
| Molecular Formula | C44H69NO9 |
| Molecular Weight | 756.03 g/mol |
| Exact Mass | 755.50 |
| IUPAC Name | (18E)-1,14-dihydroxy-12-[(E)-1-(4-hydroxy-3-methylcyclohexyl)prop-1-en-2-yl]-13,19,21,23,25,27-hexamethyl-17-prop-2-enyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
| SMILES | C=CCC1/C=C(\C)CC(C)CC(C)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(/C(C)=C/C3CCC(O)C(C)C3)C(C)C(O)CC1=O)C(C)CC2C |
| InChI | InChI=1S/C44H69NO9/c1-10-13-34-20-26(3)18-25(2)19-28(5)39-29(6)21-31(8)44(52,54-39)41(49)42(50)45-17-12-11-14-35(45)43(51)53-40(32(9)37(47)24-38(34)48)30(7)23-33-15-16-36(46)27(4)22-33/h10,20,23,25,27-29,31-37,39-40,46-47,52H,1,11-19,21-22,24H2,2-9H3/b26-20+,30-23+ |
| InChIKey | GFWAESZIAXTJBL-XEKIVPGTSA-N |
| XLogP | 6.50 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.03 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|