C26H20N4O2 — CID 67561586
3-[(4S)-4-aminocyclopent-2-en-1-yl]-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 67561586) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-[(4S)-4-aminocyclopent-2-en-1-yl]-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-[(4S)-4-aminocyclopent-2-en-1-yl]-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 67561586 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-[(4S)-4-aminocyclopent-2-en-1-yl]-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | CN1C(=O)c2c(c3c4ccccc4n(C4C=C[C@@H](N)C4)c3c3[nH]c4ccccc4c23)C1=O |
| InChI | InChI=1S/C26H20N4O2/c1-29-25(31)21-19-15-6-2-4-8-17(15)28-23(19)24-20(22(21)26(29)32)16-7-3-5-9-18(16)30(24)14-11-10-13(27)12-14/h2-11,13-14,28H,12,27H2,1H3/t13-,14?/m1/s1 |
| InChIKey | FCVZQYCVXNYIAK-KWCCSABGSA-N |
| XLogP | 4.48 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|