About 2-ethyl-3a,7a-dihydro-1,3-benzothiazole
2-ethyl-3a,7a-dihydro-1,3-benzothiazole (PubChem CID 67561612) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 2-ethyl-3a,7a-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-ethyl-3a,7a-dihydro-1,3-benzothiazole |
| PubChem CID | 67561612 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-ethyl-3a,7a-dihydro-1,3-benzothiazole |
| SMILES | CCC1=NC2C=CC=CC2S1 |
| InChI | InChI=1S/C9H11NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-8H,2H2,1H3 |
| InChIKey | YHXXAOBPDDHQDV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3a,7a-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3a,7a-dihydro-1,3-benzothiazole?
The IUPAC name of 2-ethyl-3a,7a-dihydro-1,3-benzothiazole (CID 67561612) is 2-ethyl-3a,7a-dihydro-1,3-benzothiazole.
What is the SMILES notation for 2-ethyl-3a,7a-dihydro-1,3-benzothiazole?
The canonical SMILES for 2-ethyl-3a,7a-dihydro-1,3-benzothiazole is CCC1=NC2C=CC=CC2S1.
What is the InChIKey of 2-ethyl-3a,7a-dihydro-1,3-benzothiazole?
The InChIKey is YHXXAOBPDDHQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-8H,2H2,1H3.
What are the key properties of 2-ethyl-3a,7a-dihydro-1,3-benzothiazole?
2-ethyl-3a,7a-dihydro-1,3-benzothiazole has a molecular weight of 165.26 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3a,7a-dihydro-1,3-benzothiazole is sourced from PubChem (CID 67561612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).