C26H28ClN3O6 — CID 67561619
prop-1-en-2-yl (2S,4R)-4-(7-chloroquinolin-4-yl)oxy-2-[[(1S,2R)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 67561619) has the molecular formula C26H28ClN3O6 and a molecular weight of 513.98 g/mol. Its IUPAC name is prop-1-en-2-yl (2S,4R)-4-(7-chloroquinolin-4-yl)oxy-2-[[(1S,2R)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-1-en-2-yl (2S,4R)-4-(7-chloroquinolin-4-yl)oxy-2-[[(1S,2R)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67561619 |
| Molecular Formula | C26H28ClN3O6 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | prop-1-en-2-yl (2S,4R)-4-(7-chloroquinolin-4-yl)oxy-2-[[(1S,2R)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@H]1C[C@@]1(NC(=O)[C@@H]1C[C@@H](Oc2ccnc3cc(Cl)ccc23)CN1C(=O)OC(=C)C)C(=O)OCC |
| InChI | InChI=1S/C26H28ClN3O6/c1-5-16-13-26(16,24(32)34-6-2)29-23(31)21-12-18(14-30(21)25(33)35-15(3)4)36-22-9-10-28-20-11-17(27)7-8-19(20)22/h5,7-11,16,18,21H,1,3,6,12-14H2,2,4H3,(H,29,31)/t16-,18+,21-,26-/m0/s1 |
| InChIKey | CHPVDZYFFNHPBI-KMMRWVGVSA-N |
| XLogP | 4.00 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|