About (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one
(4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one (PubChem CID 67561738) has the molecular formula C21H26O5
and a molecular weight of 358.43 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one.
Molecular Properties
| Compound Name | (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one |
| PubChem CID | 67561738 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one |
| SMILES | O=C(CC1CCC2(CC1)OCCO2)C1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H26O5/c22-18(13-16-6-8-21(9-7-16)25-10-11-26-21)19-17(14-24-20(19)23)12-15-4-2-1-3-5-15/h1-5,16-17,19H,6-14H2/t17-,19?/m0/s1 |
| InChIKey | ZCOIGHIJIIZKRH-KKFHFHRHSA-N |
| XLogP | 2.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one?
The IUPAC name of (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one (CID 67561738) is (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one.
What is the SMILES notation for (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one?
The canonical SMILES for (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one is O=C(CC1CCC2(CC1)OCCO2)C1C(=O)OC[C@@H]1Cc1ccccc1.
What is the InChIKey of (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one?
The InChIKey is ZCOIGHIJIIZKRH-KKFHFHRHSA-N. The full InChI is InChI=1S/C21H26O5/c22-18(13-16-6-8-21(9-7-16)25-10-11-26-21)19-17(14-24-20(19)23)12-15-4-2-1-3-5-15/h1-5,16-17,19H,6-14H2/t17-,19?/m0/s1.
What are the key properties of (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one?
(4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one has a molecular weight of 358.43 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-benzyl-3-[2-(1,4-dioxaspiro[4.5]decan-8-yl)acetyl]oxolan-2-one is sourced from PubChem (CID 67561738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).