About 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide
2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide (PubChem CID 67561779) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide |
| PubChem CID | 67561779 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide |
| SMILES | CC1=CCC=C(N(C)C(=O)CN(C)C)C=C1 |
| InChI | InChI=1S/C13H20N2O/c1-11-6-5-7-12(9-8-11)15(4)13(16)10-14(2)3/h6-9H,5,10H2,1-4H3 |
| InChIKey | NESFOOKPWBCZMX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The IUPAC name of 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide (CID 67561779) is 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide.
What is the SMILES notation for 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The canonical SMILES for 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide is CC1=CCC=C(N(C)C(=O)CN(C)C)C=C1.
What is the InChIKey of 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The InChIKey is NESFOOKPWBCZMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-11-6-5-7-12(9-8-11)15(4)13(16)10-14(2)3/h6-9H,5,10H2,1-4H3.
What are the key properties of 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide has a molecular weight of 220.32 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide is sourced from PubChem (CID 67561779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).